What is the chemical name for H3P?

H3P : Summary

Code	H3P
Molecule name	2,2′-methanediylbis(3,4,6-trichlorophenol)
Systematic names	Program Version Name ACDLabs 10.04 2,2′-methanediylbis(3,4,6-trichlorophenol) OpenEye OEToolkits 1.5.0 3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxy-phenyl)methyl]phenol
Formula	C13 H6 Cl6 O2
Formal charge	0

What is the name of P2O5?

tricyclo[3.3.1.13,7]tetraphosphoxane 1,3,5,7-tetraoxide
Phosphorus pentoxide/IUPAC ID

What is the name for the compound with the formula B2Cl4?

Diboron tetrachloride
Diboron tetrachloride

PubChem CID	139548
Structure	Find Similar Structures
Molecular Formula	B2Cl4
Synonyms	Diboron tetrachloride B2Cl4 13701-67-2 UNII-3KKJ90L3I5 dichloro(dichloroboranyl)borane More…
Molecular Weight	163.4

How many single bonds are in N2H4?

(e) N2H4: Each nitrogen atom (Group 5A) will make three bonds, one single bond with the other nitrogen and one each with two hydrogens.

What is the molar mass of H3P?

Identification of Phosphine Chemical Compound

Chemical Formula	H3P
Molecular Weight	33.99758 g/mol
IUPAC Name	phosphane
SMILES String	P
InChI	InChI=1S/H3P/h1H3

What is the name of Cl2O7?

Chlorine heptoxide Dichlorine
Chlorine heptoxide

PubChem CID	123272
Structure	Find Similar Structures
Molecular Formula	Cl2O7
Synonyms	Chlorine heptoxide Dichlorine heptoxide Perchloric anhydride Chlorine oxide (Cl2O7) 12015-53-1 More…
Molecular Weight	182.90

What is the name for the compound with the formula Ba3N2?

Barium nitride (Ba3N2)

What is the correct Iupac name for P4S3?

Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE

IUPAC Name
Alternative Names	Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE Trisulfurated phosphorus Phosphorous sesquisulfide Tetraphosphorus trisulphide
Molecular Formula	P4S3
Molar Mass	220.075 g/mol
InChI	InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2

How many single bonds are in H3P?

Draw the Lewis Structure for H3P (phosphorus follows the octet rule). How many electron domains are around the central atom? Phosphorus is the central atom with 4 electron domains; three single bonds and one pair of nonbonding electrons.